Difference between revisions of "Ec-01 008360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7587 PWY-7587] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7587 PWY-7587] ==
* smiles:
+
* taxonomic range:
** CC1(OC(C(C(C1O)O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
* inchi key:
+
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
+
 
* common name:
 
* common name:
** β-L-fucopyranose
+
** oleate biosynthesis III (cyanobacteria)
* molecular weight:
+
** 164.158   
+
 
* Synonym(s):
 
* Synonym(s):
** β-L-fucose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-16024]]
* [[RXN0-5298]]
+
** 1 associated gene(s):
 +
*** [[Ec-01_003960]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16067]]
 +
** 4 associated gene(s):
 +
*** [[Ec-21_003240]]
 +
*** [[Ec-12_004670]]
 +
*** [[Ec-02_006160]]
 +
*** [[Ec-26_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16023 RXN-16023]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB03283
+
{{#set: taxonomic range=TAX-1117}}
* PUBCHEM:
+
{{#set: common name=oleate biosynthesis III (cyanobacteria)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
+
{{#set: reaction found=2}}
* HMDB : HMDB59625
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=67.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
+
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
+
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
+
{{#set: common name=β-L-fucopyranose}}
+
{{#set: molecular weight=164.158    }}
+
{{#set: common name=β-L-fucose}}
+
{{#set: consumed or produced by=RXN0-5298}}
+

Revision as of 20:22, 17 March 2018

Pathway PWY-7587

  • taxonomic range:
  • common name:
    • oleate biosynthesis III (cyanobacteria)
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links