Difference between revisions of "THIAMIN-PYROPHOSPHOKINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7813 RXN-7813] == * direction: ** LEFT-TO-RIGHT * common name: ** Prenyltransferase/squalene ox...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7813 RXN-7813] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Prenyltransferase/squalene oxidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-4211]][c] '''+''' 1 [[4-PRENYLPHLORISOBUTYROPHENONE]][c] '''=>''' 1 [[CPD-7107]][c] '''+''' 1 [[PPI]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 dimethylallyl diphosphate[c] '''+''' 1 4-prenylphlorisobutyrophenone[c] '''=>''' 1 diprenylphlorisobutyrophenone[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-07_006170]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5808]], hyperforin and adhyperforin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-5133]], cohumulone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5133 PWY-5133] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Prenyltransferase/squalene oxidase}} | |
− | + | {{#set: ec number=EC-2.5.1}} | |
− | + | {{#set: gene associated=Ec-07_006170}} | |
− | + | {{#set: in pathway=PWY-5808|PWY-5133}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:24, 17 March 2018
Contents
Reaction RXN-7813
- direction:
- LEFT-TO-RIGHT
- common name:
- Prenyltransferase/squalene oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-4211[c] + 1 4-PRENYLPHLORISOBUTYROPHENONE[c] => 1 CPD-7107[c] + 1 PPI[c]
- With common name(s):
- 1 dimethylallyl diphosphate[c] + 1 4-prenylphlorisobutyrophenone[c] => 1 diprenylphlorisobutyrophenone[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-07_006170
- ESILICULOSUS_GENOME
- AUTOMATED-NAME-MATCH
- ESILICULOSUS_GENOME
Pathways
- PWY-5808, hyperforin and adhyperforin biosynthesis: PWY-5808
- 1 reactions found over 6 reactions in the full pathway
- PWY-5133, cohumulone biosynthesis: PWY-5133
- 1 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome