Difference between revisions of "THIAMIN-PYROPHOSPHOKINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7813 RXN-7813] == * direction: ** LEFT-TO-RIGHT * common name: ** Prenyltransferase/squalene ox...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7813 RXN-7813] ==
−
* smiles:
+
* direction:
−
** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N
+
 
* common name:
 
* common name:
−
** (2R,3S,4S)-leucocyanidin
+
** Prenyltransferase/squalene oxidase
−
* molecular weight:
+
* ec number:
−
** 306.271   
+
** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-trans-3,4-cis-leucocyanidin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-602]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-4211]][c] '''+''' 1 [[4-PRENYLPHLORISOBUTYROPHENONE]][c] '''=>''' 1 [[CPD-7107]][c] '''+''' 1 [[PPI]][c]
−
* [[RXN-600]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 dimethylallyl diphosphate[c] '''+''' 1 4-prenylphlorisobutyrophenone[c] '''=>''' 1 diprenylphlorisobutyrophenone[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-07_006170]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5808]], hyperforin and adhyperforin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5133]], cohumulone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5133 PWY-5133]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440833 440833]
+
{{#set: common name=Prenyltransferase/squalene oxidase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.5.1}}
−
** [http://www.chemspider.com/Chemical-Structure.389677.html 389677]
+
{{#set: gene associated=Ec-07_006170}}
−
* CHEBI:
+
{{#set: in pathway=PWY-5808|PWY-5133}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11412 11412]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC11412
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05906 C05906]
+
−
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)}}
+
−
{{#set: inchi key=InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N}}
+
−
{{#set: common name=(2R,3S,4S)-leucocyanidin}}
+
−
{{#set: molecular weight=306.271    }}
+
−
{{#set: common name=2,3-trans-3,4-cis-leucocyanidin}}
+
−
{{#set: consumed by=RXN-602}}
+
−
{{#set: produced by=RXN-600}}
+

Revision as of 21:24, 17 March 2018

Reaction RXN-7813

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Prenyltransferase/squalene oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dimethylallyl diphosphate[c] + 1 4-prenylphlorisobutyrophenone[c] => 1 diprenylphlorisobutyrophenone[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5808, hyperforin and adhyperforin biosynthesis: PWY-5808
    • 1 reactions found over 6 reactions in the full pathway
  • PWY-5133, cohumulone biosynthesis: PWY-5133
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=THIAMIN-PYROPHOSPHOKINASE-RXN&oldid=8791"