Difference between revisions of "PWY-2541"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-08_003110 == * left end position: ** 2936033 * transcription direction: ** NEGATIVE * right end position: ** 2943565 * centisome position: ** 43.8...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-08_003110 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
−
* left end position:
+
* smiles:
−
** 2936033
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
−
* right end position:
+
* common name:
−
** 2943565
+
** gibberellin A12
−
* centisome position:
+
* molecular weight:
−
** 43.840588    
+
** 330.423    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0126_0001
+
** C20-GAs
−
** Esi0126_0001
+
** open lactone gibberrellin skeleton
 +
** C20 skeleton
 +
** C20-GA skeleton
 +
** C20-gibberellin skeleton
 +
** GA12
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PHOSCHOL-RXN]]
+
* [[RXN1F-162]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN1F-161]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-3561]]
+
−
* [[PWY-7039]]
+
−
* [[LIPASYN-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2936033}}
+
* LIPID_MAPS : LMPR0104170014
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=2943565}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
−
{{#set: centisome position=43.840588   }}
+
* CHEBI:
−
{{#set: common name=Esi_0126_0001|Esi0126_0001}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
−
{{#set: reaction associated=PHOSCHOL-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-3561|PWY-7039|LIPASYN-PWY}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
 +
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
 +
{{#set: common name=gibberellin A12}}
 +
{{#set: molecular weight=330.423   }}
 +
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
 +
{{#set: consumed by=RXN1F-162}}
 +
{{#set: produced by=RXN1F-161}}

Revision as of 20:24, 17 March 2018

Metabolite CPD1F-95

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
  • common name:
    • gibberellin A12
  • molecular weight:
    • 330.423
  • Synonym(s):
    • C20-GAs
    • open lactone gibberrellin skeleton
    • C20 skeleton
    • C20-GA skeleton
    • C20-gibberellin skeleton
    • GA12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-2541&oldid=8800"