Difference between revisions of "CANAVANINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-19_003770 == * Synonym(s): ** Esi_0088_0028 ** Esi0088_0028 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_003770 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0088_0028 |
− | ** | + | ** Esi0088_0028 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[RXN-8443]] |
− | + | ** [[pantograph]]-[[aragem]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | * [[PWY-5381]] |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0088_0028|Esi0088_0028}} | |
− | + | {{#set: reaction associated=RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:26, 17 March 2018
Gene Ec-19_003770
- Synonym(s):
- Esi_0088_0028
- Esi0088_0028