Difference between revisions of "GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9651 RXN-9651] == * direction: ** LEFT-TO-RIGHT * common name: ** Thiolase-like, subgroup ** Be...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9651 RXN-9651] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
 
* common name:
 
* common name:
−
** Thiolase-like, subgroup
+
** 3-oxo-(11Z)-octadecenoyl-CoA
−
** Beta-ketoacyl synthase, N-terminal
+
* molecular weight:
−
** beta-ketoacyl synthase, partial
+
** 1041.936   
−
** 3-oxoacyl-[acyl-carrier-protein] synthase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-18:1-Δ11-CoA
 +
** 3-oxo-11-cis-octadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[Octanoyl-ACPs]][c] '''=>''' 1 [[3-oxo-decanoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN-17786]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 an octanoyl-[acp][c] '''=>''' 1 a 3-oxo-decanoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_002090]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-27_003480]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-12_000640]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-12_000650]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''20''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=Thiolase-like, subgroup}}
+
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
−
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
+
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
−
{{#set: common name=beta-ketoacyl synthase, partial}}
+
{{#set: molecular weight=1041.936    }}
−
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
+
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
−
{{#set: ec number=EC-2.3.1.86}}
+
{{#set: produced by=RXN-17786}}
−
{{#set: ec number=EC-2.3.1.85}}
+
−
{{#set: ec number=EC-2.3.1.41}}
+
−
{{#set: gene associated=Ec-27_002090|Ec-27_003480|Ec-12_000640|Ec-12_000650}}
+
−
{{#set: in pathway=PWY-5994}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 21:27, 17 March 2018

Metabolite CPD-19160

  • smiles:
    • CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
  • common name:
    • 3-oxo-(11Z)-octadecenoyl-CoA
  • molecular weight:
    • 1041.936
  • Synonym(s):
    • 3-oxo-18:1-Δ11-CoA
    • 3-oxo-11-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN&oldid=8960"