Difference between revisions of "3.1.3.56-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=UYUXSRADSPPKRZ-SKNVOMKLSA-N
+
 
* common name:
 
* common name:
−
** D-glucurono-6,3-lactone
+
** tRNA splicing
−
* molecular weight:
+
−
** 176.126   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-glucurono-3,6-lactone
 
−
** D-glucuronolactone
 
−
** glucuronolactone
 
−
** D-glucofuranuronate γ-lactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2.7.1.160-RXN]]
−
* [[RXN-14225]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[3.1.27.9-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_006500]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10034]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12055]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12056]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 32449-92-6
+
{{#set: taxonomic range=TAX-2157}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92283 92283]
+
{{#set: common name=tRNA splicing}}
−
* HMDB : HMDB06355
+
{{#set: reaction found=5}}
−
* LIGAND-CPD:
+
{{#set: total reaction=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06430 C06430]
+
{{#set: completion rate=100.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.190202.html 190202]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18268 18268]
+
−
* METABOLIGHTS : MTBLC18268
+
−
{{#set: smiles=C1(=O)(C(O)C(O)[CH](C(O)C=O)O1)}}
+
−
{{#set: inchi key=InChIKey=UYUXSRADSPPKRZ-SKNVOMKLSA-N}}
+
−
{{#set: common name=D-glucurono-6,3-lactone}}
+
−
{{#set: molecular weight=176.126    }}
+
−
{{#set: common name=D-glucurono-3,6-lactone|D-glucuronolactone|glucuronolactone|D-glucofuranuronate γ-lactone}}
+
−
{{#set: consumed or produced by=RXN-14225}}
+

Revision as of 20:30, 17 March 2018

Pathway PWY-6689

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.1.3.56-RXN&oldid=9178"