Difference between revisions of "DETOX1-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-02_001380 == * left end position: ** 1699580 * transcription direction: ** POSITIVE * right end position: ** 1709041 * centisome position: ** 26.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_001380 == |
− | * | + | * left end position: |
− | ** | + | ** 1699580 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1709041 |
− | * | + | * centisome position: |
− | ** | + | ** 26.036066 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0055_0009 |
+ | ** Esi0055_0009 | ||
+ | ** CDPK;2 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1699580}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1709041}} | |
− | + | {{#set: centisome position=26.036066 }} | |
− | + | {{#set: common name=Esi_0055_0009|Esi0055_0009|CDPK;2}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 20:30, 17 March 2018
Gene Ec-02_001380
- left end position:
- 1699580
- transcription direction:
- POSITIVE
- right end position:
- 1709041
- centisome position:
- 26.036066
- Synonym(s):
- Esi_0055_0009
- Esi0055_0009
- CDPK;2
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome