Difference between revisions of "GLYCINE-SYN2-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] == * common name: ** an [eIF5A-precursor]-deoxyhypusine * Synonym(s): ** a p...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C | ||
| + | * inchi key: | ||
| + | ** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 14-oxolanosterol |
| + | * molecular weight: | ||
| + | ** 440.708 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 14-oxo-lanosterol |
| − | ** | + | ** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-305]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-304]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203567 25203567] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}} |
| − | {{#set: | + | {{#set: common name=14-oxolanosterol}} |
| + | {{#set: molecular weight=440.708 }} | ||
| + | {{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}} | ||
| + | {{#set: consumed by=RXN66-305}} | ||
| + | {{#set: produced by=RXN66-304}} | ||
Revision as of 20:31, 17 March 2018
Contents
Metabolite CPD-4573
- smiles:
- CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
- inchi key:
- InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
- common name:
- 14-oxolanosterol
- molecular weight:
- 440.708
- Synonym(s):
- 14-oxo-lanosterol
- 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.
