Difference between revisions of "RXN-13614"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10262 CPD-10262] == * smiles: ** CCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10262 CPD-10262] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NBCCUIHOHUKBMK-ZDDAFBBHSA-J |
* common name: | * common name: | ||
− | ** | + | ** trans-octadec-2-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1027.953 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** trans-2,3-dihydro-stearenoyl-CoA |
− | + | ** (2E)-octadecenoyl-CoA | |
− | + | ||
− | + | ||
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9546]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16218 C16218] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71412 71412] |
− | * | + | * BIGG : 1452075 |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244344 25244344] |
− | {{#set: common name= | + | * HMDB : HMDB06529 |
− | {{#set: molecular weight= | + | {{#set: smiles=CCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=NBCCUIHOHUKBMK-ZDDAFBBHSA-J}} |
− | {{#set: consumed by= | + | {{#set: common name=trans-octadec-2-enoyl-CoA}} |
− | + | {{#set: molecular weight=1027.953 }} | |
+ | {{#set: common name=trans-2,3-dihydro-stearenoyl-CoA|(2E)-octadecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-9546}} |
Revision as of 20:32, 17 March 2018
Contents
Metabolite CPD-10262
- smiles:
- CCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- inchi key:
- InChIKey=NBCCUIHOHUKBMK-ZDDAFBBHSA-J
- common name:
- trans-octadec-2-enoyl-CoA
- molecular weight:
- 1027.953
- Synonym(s):
- trans-2,3-dihydro-stearenoyl-CoA
- (2E)-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.