Difference between revisions of "RXN1G-1053"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * smiles: ** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-trans,4-trans-tetradecadienoyl-CoA |
| + | * molecular weight: | ||
| + | ** 969.83 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-14715]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659084 90659084] |
| − | {{#set: common name | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87712 87712] | |
| − | {{#set: | + | {{#set: smiles=CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J}} |
| + | {{#set: common name=2-trans,4-trans-tetradecadienoyl-CoA}} | ||
| + | {{#set: molecular weight=969.83 }} | ||
| + | {{#set: consumed by=RXN-14715}} | ||
Revision as of 20:38, 17 March 2018
Contents
Metabolite CPD-15566
- smiles:
- CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J
- common name:
- 2-trans,4-trans-tetradecadienoyl-CoA
- molecular weight:
- 969.83
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
