Difference between revisions of "Ec-08 002500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P101-PWY P101-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P101-PWY P101-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
+
 
* common name:
 
* common name:
−
** D-myo-inositol (1,3,4)-trisphosphate
+
** ectoine biosynthesis
−
* molecular weight:
+
−
** 414.049   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4)P3
 
−
** 1-D-myo-inositol (1,3,4)-trisphosphate
 
−
** inositol 1,3,4-trisphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[2.7.1.139-RXN]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-10939]]
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
−
* [[2.7.1.133-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) known to produce the compound ==
+
*** [[Ec-01_007470]]
−
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ASPARTATEKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-11_000830]]
 +
*** [[Ec-13_002530]]
 +
*** [[Ec-27_003730]]
 +
*** [[Ec-24_000610]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R101-RXN R101-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R102-RXN R102-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R103-RXN R103-RXN]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243]
+
{{#set: common name=ectoine biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414]
+
{{#set: total reaction=5}}
−
* METABOLIGHTS : MTBLC58414
+
{{#set: completion rate=40.0}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948]
+
−
* HMDB : HMDB01143
+
−
{{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
−
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}}
+
−
{{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}}
+
−
{{#set: molecular weight=414.049    }}
+
−
{{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}}
+
−
{{#set: consumed by=2.7.1.139-RXN|RXN-10939|2.7.1.133-RXN}}
+

Revision as of 20:38, 17 March 2018

Pathway P101-PWY

  • taxonomic range:
  • common name:
    • ectoine biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_002500&oldid=9752"