Difference between revisions of "PWY-7430"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6381 RXN-6381] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6381 RXN-6381] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
+
** [http://enzyme.expasy.org/EC/1.4.3.22 EC-1.4.3.22]
−
* common name:
+
−
** (22α)-hydroxy-campest-4-en-3-one
+
−
* molecular weight:
+
−
** 414.67   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (22S)-22-hydroxy-campest-4-en-3-one
 
−
** (22S,24R)-22-hydroxy-ergost-4-en-3-one
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-4231]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-313]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[CPD-6082]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 propane-1,3-diamine[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 ammonium[c] '''+''' 1 3-aminopropanal[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-15_002920]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-15_002910]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
* [[PWY-3981]], β-alanine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3981 PWY-3981]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01031116
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30895 30895]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201842 25201842]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03139 R03139]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.4.3.22}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796]
+
{{#set: gene associated=Ec-15_002920|Ec-15_002910}}
−
* HMDB : HMDB12113
+
{{#set: in pathway=PWY-3981}}
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: common name=(22α)-hydroxy-campest-4-en-3-one}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=414.67    }}
+
−
{{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}}
+
−
{{#set: produced by=RXN-4231}}
+

Revision as of 20:39, 17 March 2018

Reaction RXN-6381

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3981, β-alanine biosynthesis I: PWY-3981
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7430&oldid=9781"