Difference between revisions of "Ec-01 006460"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHEME SIROHEME] == * smiles: ** CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O...")
 
(Created page with "Category:Gene == Gene Ec-05_000950 == * left end position: ** 2071506 * transcription direction: ** POSITIVE * right end position: ** 2084568 * centisome position: ** 22.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHEME SIROHEME] ==
+
== Gene Ec-05_000950 ==
−
* smiles:
+
* left end position:
−
** CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O)[O-])=C7(N([Fe--]25([N+]1(C(C(CCC([O-])=O)=C(CC(=O)[O-])C=1C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(N23)=CC4=[N+]56))=C7)))8))))
+
** 2071506
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DLKSSIHHLYNIKN-QIISWYHFSA-D
+
** POSITIVE
−
* common name:
+
* right end position:
−
** siroheme
+
** 2084568
−
* molecular weight:
+
* centisome position:
−
** 908.611    
+
** 22.755041    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0169_0029
 +
** Esi0169_0029
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[5-NUCLEOTID-RXN]]
−
* [[SIROHEME-FERROCHELAT-RXN]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
* [[AMP-DEPHOSPHORYLATION-RXN]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14025]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14026]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14227]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-5841]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-7607]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-7609]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[XMPXAN-RXN]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5381]]
 +
* [[PWY-6607]]
 +
* [[PWY-7185]]
 +
* [[SALVADEHYPOX-PWY]]
 +
* [[PWY-6596]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 +
* [[PWY-6606]]
 +
* [[PWY-6608]]
 +
* [[PWY-5695]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2071506}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678579 70678579]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2084568}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60052 60052]
+
{{#set: centisome position=22.755041    }}
−
* BIGG : 35869
+
{{#set: common name=Esi_0169_0029|Esi0169_0029}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00748 C00748]
+
{{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}}
−
{{#set: smiles=CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O)[O-])=C7(N([Fe--]25([N+]1(C(C(CCC([O-])=O)=C(CC(=O)[O-])C=1C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(N23)=CC4=[N+]56))=C7)))8))))}}
+
−
{{#set: inchi key=InChIKey=DLKSSIHHLYNIKN-QIISWYHFSA-D}}
+
−
{{#set: common name=siroheme}}
+
−
{{#set: molecular weight=908.611    }}
+
−
{{#set: produced by=SIROHEME-FERROCHELAT-RXN}}
+

Revision as of 20:41, 17 March 2018

Gene Ec-05_000950

  • left end position:
    • 2071506
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2084568
  • centisome position:
    • 22.755041
  • Synonym(s):
    • Esi_0169_0029
    • Esi0169_0029

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_006460&oldid=9952"