Difference between revisions of "CPD-85"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17319 CPD-17319] == * smiles: ** CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCC=CC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == |
* smiles: | * smiles: | ||
− | ** | + | ** CSCCC(C([O-])=CO)=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M |
* common name: | * common name: | ||
− | ** 1- | + | ** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 161.195 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 1,2-dihydroxy-3-keto-5-methylthiopentene anion | ||
+ | ** 1,2-dihydroxy-3-keto-5-methylthiopentane | ||
+ | ** 1,2-dihydroxy-3-keto-5-methylthiopentene | ||
+ | ** acireductone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R147-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606] |
− | {{#set: common name=1- | + | * HMDB : HMDB12134 |
− | {{#set: molecular weight= | + | {{#set: smiles=CSCCC(C([O-])=CO)=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}} |
+ | {{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}} | ||
+ | {{#set: molecular weight=161.195 }} | ||
+ | {{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}} | ||
+ | {{#set: consumed by=R147-RXN}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-85
- smiles:
- CSCCC(C([O-])=CO)=O
- inchi key:
- InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
- common name:
- 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
- molecular weight:
- 161.195
- Synonym(s):
- 1,2-dihydroxy-3-keto-5-methylthiopentene anion
- 1,2-dihydroxy-3-keto-5-methylthiopentane
- 1,2-dihydroxy-3-keto-5-methylthiopentene
- acireductone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCC(C([O-])=CO)=O" cannot be used as a page name in this wiki.