Difference between revisions of "CPD1F-140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-746 RXN0-746] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-triphosphate r...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-746 RXN0-746] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
 
* common name:
 
* common name:
** ribonucleoside-triphosphate reductase
+
** gibberellin A20
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.17.4.2 EC-1.17.4.2]
+
** 331.388   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA20
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-113]]
** 1 [[Reduced-flavodoxins]][c] '''+''' 1 [[GTP]][c] '''=>''' 1 [[DGTP]][c] '''+''' 1 [[Oxidized-flavodoxins]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a reduced flavodoxin[c] '''+''' 1 GTP[c] '''=>''' 1 dGTP[c] '''+''' 1 an oxidized flavodoxin[c] '''+''' 1 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-04_006460]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY-7222]], guanosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7222 PWY-7222]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=ribonucleoside-triphosphate reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
{{#set: ec number=EC-1.17.4.2}}
+
* CHEBI:
{{#set: gene associated=Ec-04_006460}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
{{#set: in pathway=PWY-7222}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
 +
{{#set: common name=gibberellin A20}}
 +
{{#set: molecular weight=331.388    }}
 +
{{#set: common name=GA20}}
 +
{{#set: consumed by=RXN-113}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD1F-140

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
  • common name:
    • gibberellin A20
  • molecular weight:
    • 331.388
  • Synonym(s):
    • GA20

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.