Difference between revisions of "PWY-6802"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] == * smiles: ** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6802 PWY-6802] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6802 PWY-6802] ==
* smiles:
+
* taxonomic range:
** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
+
** salidroside biosynthesis
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''4''' reactions in the full pathway
* [[RXN-15271]]
+
* [[RXN-5821]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-15_002910]]
 +
*** [[Ec-15_002920]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[TYROSINE-DECARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-14_004250]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12370 RXN-12370]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-4113 RXN3O-4113]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: common name=α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}}
+
{{#set: common name=salidroside biosynthesis}}
{{#set: produced by=RXN-15271}}
+
{{#set: reaction found=2}}
 +
{{#set: total reaction=4}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 19:10, 21 March 2018

Pathway PWY-6802

  • taxonomic range:
  • common name:
    • salidroside biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links