Difference between revisions of "DIHYDRO-DIOH-BENZOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([O-])(=O)C1(=CC=CC(C1O)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M |
* common name: | * common name: | ||
| − | ** (2S)- | + | ** (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 155.13 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DHBDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266758 45266758] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.19951064.html 19951064] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58764 58764] |
| − | * | + | * BIGG : 43290 |
| − | {{#set: smiles | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04171 C04171] |
| − | {{#set: common name=(2S)- | + | {{#set: smiles=C([O-])(=O)C1(=CC=CC(C1O)O)}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M}} |
| − | {{#set: | + | {{#set: common name=(2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate}} |
| − | + | {{#set: molecular weight=155.13 }} | |
| + | {{#set: consumed by=DHBDEHYD-RXN}} | ||
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite DIHYDRO-DIOH-BENZOATE
- smiles:
- C([O-])(=O)C1(=CC=CC(C1O)O)
- inchi key:
- InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M
- common name:
- (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate
- molecular weight:
- 155.13
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC=CC(C1O)O)" cannot be used as a page name in this wiki.
