Difference between revisions of "3-OXOACYL-ACP-SYNTH-BASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * inchi key: ** InChIKey=OYIFNH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-OXOACYL-ACP-SYNTH-BASE-RXN 3-OXOACYL-ACP-SYNTH-BASE-RXN] == * direction: ** LEFT-TO-RIGHT * commo...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-OXOACYL-ACP-SYNTH-BASE-RXN 3-OXOACYL-ACP-SYNTH-BASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Beta-ketoacyl synthase, N-terminal |
− | * | + | ** Thiolase-like, subgroup |
− | ** | + | ** beta-ketoacyl synthase, partial |
+ | ** 3-oxoacyl-[acyl-carrier-protein] synthase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[ACETYL-ACP]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[Acetoacetyl-ACPs]][c] '''+''' 1 [[ACP]][c] |
− | * [[1.2. | + | * With common name(s): |
− | == | + | ** 1 H+[c] '''+''' 1 an acetyl-[acp][c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 CO2[c] '''+''' 1 an acetoacetyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_002090]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-12_000650]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-27_003480]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-12_000640]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5965]], fatty acid biosynthesis initiation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5965 PWY-5965] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-5966]], fatty acid biosynthesis initiation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5966 PWY-5966] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[FASYN-INITIAL-PWY]], superpathway of fatty acid biosynthesis initiation (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=FASYN-INITIAL-PWY FASYN-INITIAL-PWY] | ||
+ | ** '''5''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P23902 P23902] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P0A6R0 P0A6R0] |
− | * | + | ** [http://www.uniprot.org/uniprot/P49327 P49327] |
− | * | + | ** [http://www.uniprot.org/uniprot/P43710 P43710] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9HYR2 Q9HYR2] |
− | * | + | ** [http://www.uniprot.org/uniprot/O67612 O67612] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P20582 P20582] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JT63 Q9JT63] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JW56 Q9JW56] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PMZ6 Q9PMZ6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43711 P43711] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O25284 O25284] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9JX65 Q9JX65] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O34340 O34340] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PI63 Q9PI63] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0AAI5 P0AAI5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q07510 Q07510] |
+ | ** [http://www.uniprot.org/uniprot/Q06097 Q06097] | ||
+ | ** [http://www.uniprot.org/uniprot/P41175 P41175] | ||
+ | ** [http://www.uniprot.org/uniprot/P31176 P31176] | ||
+ | ** [http://www.uniprot.org/uniprot/Q40027 Q40027] | ||
+ | ** [http://www.uniprot.org/uniprot/Q40028 Q40028] | ||
+ | ** [http://www.uniprot.org/uniprot/P73283 P73283] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A953 P0A953] | ||
+ | ** [http://www.uniprot.org/uniprot/O64485 O64485] | ||
+ | ** [http://www.uniprot.org/uniprot/O65677 O65677] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39310 Q39310] | ||
+ | ** [http://www.uniprot.org/uniprot/O23738 O23738] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41134 Q41134] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41135 Q41135] | ||
+ | ** [http://www.uniprot.org/uniprot/Q54208 Q54208] | ||
+ | ** [http://www.uniprot.org/uniprot/O54440 O54440] | ||
+ | ** [http://www.uniprot.org/uniprot/P55338 P55338] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RA31 Q9RA31] | ||
+ | ** [http://www.uniprot.org/uniprot/P12276 P12276] | ||
+ | ** [http://www.uniprot.org/uniprot/P12785 P12785] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Beta-ketoacyl synthase, N-terminal}} | ||
+ | {{#set: common name=Thiolase-like, subgroup}} | ||
+ | {{#set: common name=beta-ketoacyl synthase, partial}} | ||
+ | {{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}} | ||
+ | {{#set: ec number=EC-2.3.1.86}} | ||
+ | {{#set: ec number=EC-2.3.1.85}} | ||
+ | {{#set: ec number=EC-2.3.1.41}} | ||
+ | {{#set: gene associated=Ec-27_002090|Ec-12_000650|Ec-27_003480|Ec-12_000640}} | ||
+ | {{#set: in pathway=PWY-5965|PWY-5966|FASYN-INITIAL-PWY|PWY-7388}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction 3-OXOACYL-ACP-SYNTH-BASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Beta-ketoacyl synthase, N-terminal
- Thiolase-like, subgroup
- beta-ketoacyl synthase, partial
- 3-oxoacyl-[acyl-carrier-protein] synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 ACETYL-ACP[c] + 1 MALONYL-ACP[c] => 1 CARBON-DIOXIDE[c] + 1 Acetoacetyl-ACPs[c] + 1 ACP[c]
- With common name(s):
- 1 H+[c] + 1 an acetyl-[acp][c] + 1 a malonyl-[acp][c] => 1 CO2[c] + 1 an acetoacetyl-[acp][c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002090
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_000650
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_003480
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_000640
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5965, fatty acid biosynthesis initiation III: PWY-5965
- 1 reactions found over 2 reactions in the full pathway
- PWY-5966, fatty acid biosynthesis initiation II: PWY-5966
- 2 reactions found over 2 reactions in the full pathway
- FASYN-INITIAL-PWY, superpathway of fatty acid biosynthesis initiation (E. coli): FASYN-INITIAL-PWY
- 5 reactions found over 8 reactions in the full pathway
- PWY-7388, octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): PWY-7388
- 9 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- UNIPROT:
"3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.