Difference between revisions of "PWY-5122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
| − | ** | + | ** geranyl diphosphate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** GPP biosynthesis |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | + | * [[GPPSYN-RXN]] | |
| − | * [[ | + | ** 12 associated gene(s): |
| − | + | *** [[Ec-21_000990]] | |
| − | * [[ | + | *** [[Ec-14_006550]] |
| + | *** [[Ec-08_002270]] | ||
| + | *** [[Ec-00_007350]] | ||
| + | *** [[Ec-25_002110]] | ||
| + | *** [[Ec-10_003020]] | ||
| + | *** [[Ec-18_000990]] | ||
| + | *** [[Ec-26_003280]] | ||
| + | *** [[Ec-17_001240]] | ||
| + | *** [[Ec-16_004330]] | ||
| + | *** [[Ec-07_006170]] | ||
| + | *** [[Ec-24_003910]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5122 PWY-5122] | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | ** [http:// | + | {{#set: common name=geranyl diphosphate biosynthesis}} |
| − | + | {{#set: common name=GPP biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=1}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:11, 21 March 2018
Pathway PWY-5122
- taxonomic range:
- common name:
- geranyl diphosphate biosynthesis
- Synonym(s):
- GPP biosynthesis
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- GPPSYN-RXN
- 12 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
