Difference between revisions of "N-Acylsphingosine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylsphingosine N-Acylsphingosine] == * common name: ** a (4E)-sphing-4-enine ceramide * Syno...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylsphingosine N-Acylsphingosine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a (4E)-sphing-4-enine ceramide |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a sphing-4-enine ceramide |
− | + | ** a sphingosine ceramide | |
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CERAMIDASE-RXN]] |
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a (4E)-sphing-4-enine ceramide}} | |
− | + | {{#set: common name=a sphing-4-enine ceramide|a sphingosine ceramide}} | |
− | + | {{#set: consumed by=CERAMIDASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | + | ||
− | + |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite N-Acylsphingosine
- common name:
- a (4E)-sphing-4-enine ceramide
- Synonym(s):
- a sphing-4-enine ceramide
- a sphingosine ceramide