Difference between revisions of "RXN-5822"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5822 RXN-5822] == * direction: ** LEFT-TO-RIGHT * common name: ** acid phosphatase * ec number:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5822 RXN-5822] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acid phosphatase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.2 EC-3.1.3.2] |
+ | ** [http://enzyme.expasy.org/EC/3.1.3.1 EC-3.1.3.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[NAD]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NADP+[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 NAD+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-21_005990]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-19_002110]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-19_000870]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-20_002470]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-07_000930]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-24_000520]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-05_000260]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-05_004740]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-27_003870]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-20_003560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-00_000940]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-26_006410]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-21_003560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-5083]], NAD/NADH phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5083 PWY-5083] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[NADPHOS-DEPHOS-PWY]], NAD phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY NADPHOS-DEPHOS-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[NAD-BIOSYNTHESIS-II]], NAD salvage pathway III: [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28050 28050] |
− | * | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00118 R00118] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=acid phosphatase}} |
− | {{#set: | + | {{#set: ec number=EC-3.1.3.2}} |
− | {{#set: | + | {{#set: ec number=EC-3.1.3.1}} |
+ | {{#set: gene associated=Ec-21_005990|Ec-19_002110|Ec-19_000870|Ec-20_002470|Ec-07_000930|Ec-24_000520|Ec-05_000260|Ec-05_004740|Ec-27_003870|Ec-20_003560|Ec-00_000940|Ec-26_006410|Ec-21_003560}} | ||
+ | {{#set: in pathway=PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction RXN-5822
- direction:
- LEFT-TO-RIGHT
- common name:
- acid phosphatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADP+[c] + 1 H2O[c] => 1 phosphate[c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-21_005990
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-19_002110
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-19_000870
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-20_002470
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_000930
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_000520
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-05_000260
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-05_004740
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_003870
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-20_003560
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-00_000940
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-26_006410
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-21_003560
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5083, NAD/NADH phosphorylation and dephosphorylation: PWY-5083
- 4 reactions found over 6 reactions in the full pathway
- NADPHOS-DEPHOS-PWY, NAD phosphorylation and dephosphorylation: NADPHOS-DEPHOS-PWY
- 3 reactions found over 3 reactions in the full pathway
- NAD-BIOSYNTHESIS-II, NAD salvage pathway III: NAD-BIOSYNTHESIS-II
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links