Difference between revisions of "PWY-6261"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
−
** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 5-hydroxyindole acetate
+
** thyroid hormone metabolism II (via conjugation and/or degradation)
−
* molecular weight:
+
−
** 190.178   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxyindoleacetic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''15''' reactions in the full pathway
−
* [[RXN-10780]]
+
* [[RXN-10614]]
−
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[Ec-06_007320]]
 +
*** [[Ec-06_007300]]
 +
*** [[Ec-06_007310]]
 +
*** [[Ec-26_003630]]
 +
*** [[Ec-00_005410]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10615]]
 +
** 5 associated gene(s):
 +
*** [[Ec-26_003630]]
 +
*** [[Ec-06_007320]]
 +
*** [[Ec-00_005410]]
 +
*** [[Ec-06_007300]]
 +
*** [[Ec-06_007310]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10606 RXN-10606]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10607 RXN-10607]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10608 RXN-10608]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10609 RXN-10609]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10610 RXN-10610]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10611 RXN-10611]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10612 RXN-10612]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10613 RXN-10613]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10616 RXN-10616]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10617 RXN-10617]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10618 RXN-10618]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10619 RXN-10619]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=THYROXINE-DEIODINASE-RXN THYROXINE-DEIODINASE-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 54-16-0
+
{{#set: taxonomic range=TAX-7742}}
−
* PUBCHEM:
+
{{#set: common name=thyroid hormone metabolism II (via conjugation and/or degradation)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821]
+
{{#set: reaction found=2}}
−
* HMDB : HMDB00763
+
{{#set: total reaction=15}}
−
* LIGAND-CPD:
+
{{#set: completion rate=13.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622]
+
−
{{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}}
+
−
{{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}}
+
−
{{#set: common name=5-hydroxyindole acetate}}
+
−
{{#set: molecular weight=190.178    }}
+
−
{{#set: common name=5-hydroxyindoleacetic acid}}
+
−
{{#set: produced by=RXN-10780}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-6261

  • taxonomic range:
  • common name:
    • thyroid hormone metabolism II (via conjugation and/or degradation)
  • Synonym(s):

Reaction(s) found

2 reactions found over 15 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6261&oldid=25203"