Difference between revisions of "RXN-11210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11210 RXN-11210] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11210 RXN-11210] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* common name:
+
* ec number:
** chlorophyllide b
+
** [http://enzyme.expasy.org/EC/3.5.1.6 EC-3.5.1.6]
* molecular weight:
+
** 626.95   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-7677]]
+
** 2 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[3-UREIDO-ISOBUTYRATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-471]][c] '''+''' 1 [[AMMONIUM]][c]
* [[RXN-13398]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 H+[c] '''+''' 1 H2O[c] '''+''' 1 (R)-3-ureido-isobutanoate[c] '''=>''' 1 CO2[c] '''+''' 1 (R)-3-amino-2-methylpropanoate[c] '''+''' 1 ammonium[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_003010]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6430]], thymine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6430 PWY-6430]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: ec number=EC-3.5.1.6}}
* CHEBI:
+
{{#set: gene associated=Ec-16_003010}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
{{#set: in pathway=PWY-6430}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: reconstruction source=orthology-aragem}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=chlorophyllide b}}
+
{{#set: molecular weight=626.95    }}
+
{{#set: produced by=RXN-7677|RXN-13398}}
+

Latest revision as of 19:07, 21 March 2018

Reaction RXN-11210

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6430, thymine degradation: PWY-6430
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links