Difference between revisions of "Ec-21 003610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-21_003610 == * left end position: ** 4593742 * transcription direction: ** POSITIVE * right end position: ** 4598672 * centisome position: ** 62.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_003610 == |
− | * | + | * left end position: |
− | ** | + | ** 4593742 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4598672 |
− | * | + | * centisome position: |
− | ** | + | ** 62.24482 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0072_0092 | ||
+ | ** Esi0072_0092 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLUTAMINESYN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[GLNSYN-PWY]] | ||
+ | * [[PWY-5675]] | ||
+ | * [[PWY-381]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-6964]] | ||
+ | * [[PWY-6963]] | ||
+ | * [[PWY490-3]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4593742}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4598672}} | |
− | + | {{#set: centisome position=62.24482 }} | |
− | + | {{#set: common name=Esi_0072_0092|Esi0072_0092}} | |
− | + | {{#set: reaction associated=GLUTAMINESYN-RXN}} | |
− | + | {{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY-6963|PWY490-3}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:12, 21 March 2018
Gene Ec-21_003610
- left end position:
- 4593742
- transcription direction:
- POSITIVE
- right end position:
- 4598672
- centisome position:
- 62.24482
- Synonym(s):
- Esi_0072_0092
- Esi0072_0092
Reactions associated
- Reaction: GLUTAMINESYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome