Difference between revisions of "RXN0-1441"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1441 RXN0-1441] == * direction: ** LEFT-TO-RIGHT * common name: ** NUDIX hydrolase * ec number...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1441 RXN0-1441] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NUDIX hydrolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.53 EC-3.6.1.53] |
+ | ** [http://enzyme.expasy.org/EC/3.6.1.13 EC-3.6.1.13] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ADENOSINE_DIPHOSPHATE_RIBOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMP]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD-15317]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 ADP-D-ribose[c] '''+''' 1 H2O[c] '''=>''' 1 AMP[c] '''+''' 2 H+[c] '''+''' 1 D-ribofuranose 5-phosphate[c] |
− | + | ||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-07_006940]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-19_002730]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10412 10412] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01054 R01054] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=NUDIX hydrolase}} |
− | + | {{#set: ec number=EC-3.6.1.53}} | |
− | + | {{#set: ec number=EC-3.6.1.13}} | |
− | + | {{#set: gene associated=Ec-07_006940|Ec-19_002730}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:12, 21 March 2018
Contents
Reaction RXN0-1441
- direction:
- LEFT-TO-RIGHT
- common name:
- NUDIX hydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ADENOSINE_DIPHOSPHATE_RIBOSE[c] + 1 WATER[c] => 1 AMP[c] + 2 PROTON[c] + 1 CPD-15317[c]
- With common name(s):
- 1 ADP-D-ribose[c] + 1 H2O[c] => 1 AMP[c] + 2 H+[c] + 1 D-ribofuranose 5-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-07_006940
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-19_002730
- Source: orthology-aragem
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links