Difference between revisions of "RXN-17784"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17784 RXN-17784] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA dehydrogenase ** A...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17784 RXN-17784] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acyl-CoA dehydrogenase |
− | * | + | ** Acyl-CoA dehydrogenase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.3.8 EC-1.3.8] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-18346]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-19163]][c] '''+''' 1 [[ETF-Reduced]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 cis-vaccenoyl-CoA[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c] '''=>''' 1 (2E,11Z)-octadecenoyl-CoA[c] '''+''' 1 a reduced electron-transfer flavoprotein[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-16_004260]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-03_003490]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-14_001600]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=acyl-CoA dehydrogenase}} | |
− | + | {{#set: common name=Acyl-CoA dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.3.8}} | |
− | + | {{#set: gene associated=Ec-16_004260|Ec-03_003490|Ec-14_001600}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:12, 21 March 2018
Contents
Reaction RXN-17784
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-CoA dehydrogenase
- Acyl-CoA dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-18346[c] + 1 ETF-Oxidized[c] + 1 PROTON[c] => 1 CPD-19163[c] + 1 ETF-Reduced[c]
- With common name(s):
- 1 cis-vaccenoyl-CoA[c] + 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c] => 1 (2E,11Z)-octadecenoyl-CoA[c] + 1 a reduced electron-transfer flavoprotein[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_004260
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_003490
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_001600
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome