Difference between revisions of "CPD-3483"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] == * direction: ** LEFT-TO-RIGHT * c...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
 +
* inchi key:
 +
** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
 
* common name:
 
* common name:
−
** protein-arginine deiminase
+
** hydroxybupropion
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.5.3.15 EC-3.5.3.15]
+
** 256.752   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Protein-L-Arginines]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTEIN-L-CITRULLINE]][c] '''+''' 1 [[AMMONIUM]][c]
+
* [[RXN66-181]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a [protein]-L-arginine[c] '''+''' 1 H2O[c] '''=>''' 1 a [protein]-L-citrulline[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_001540]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-4921]], protein citrullination: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4921 PWY-4921]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02621 R02621]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442]
−
* UNIPROT:
+
* HMDB : HMDB12235
−
** [http://www.uniprot.org/uniprot/Q08642 Q08642]
+
{{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}}
−
** [http://www.uniprot.org/uniprot/P20717 P20717]
+
{{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}}
−
** [http://www.uniprot.org/uniprot/P70708 P70708]
+
{{#set: common name=hydroxybupropion}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=256.752    }}
−
{{#set: common name=protein-arginine deiminase}}
+
{{#set: produced by=RXN66-181}}
−
{{#set: ec number=EC-3.5.3.15}}
+
−
{{#set: gene associated=Ec-02_001540}}
+
−
{{#set: in pathway=PWY-4921}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:12, 21 March 2018

Metabolite CPD-3483

  • smiles:
    • CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
  • inchi key:
    • InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
  • common name:
    • hydroxybupropion
  • molecular weight:
    • 256.752
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-3483&oldid=25332"