Difference between revisions of "PWY-5138"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138] ==
−
* smiles:
+
* taxonomic range:
−
** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
+
 
* common name:
 
* common name:
−
** β-D-cellobiose
+
** unsaturated, even numbered fatty acid β-oxidation
−
* molecular weight:
+
−
** 342.299   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-O-β-D-glucopyranosyl-β-D-glucopyranose
+
** fatty acid β-oxidation IV (unsaturated, even number)
−
** β-D-glucosyl-(1→4)-β-D-glucose
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10773]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ENOYL-COA-HYDRAT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_003560]]
 +
*** [[Ec-16_001250]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7835]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_003950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHBUTYRYL-COA-EPIM-RXN OHBUTYRYL-COA-EPIM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7699 RXN-7699]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836]
 
== External links  ==
 
== External links  ==
−
* CAS : 528-50-7
+
* ARACYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5138 PWY-5138]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712]
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB00055
+
{{#set: common name=unsaturated, even numbered fatty acid β-oxidation}}
−
* LIGAND-CPD:
+
{{#set: common name=fatty acid β-oxidation IV (unsaturated, even number)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422]
+
{{#set: reaction found=2}}
−
* CHEMSPIDER:
+
{{#set: total reaction=5}}
−
** [http://www.chemspider.com/Chemical-Structure.10261.html 10261]
+
{{#set: completion rate=40.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217]
+
−
{{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}}
+
−
{{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}}
+
−
{{#set: common name=β-D-cellobiose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}}
+
−
{{#set: consumed by=RXN-10773}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-5138

  • taxonomic range:
  • common name:
    • unsaturated, even numbered fatty acid β-oxidation
  • Synonym(s):
    • fatty acid β-oxidation IV (unsaturated, even number)

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5138&oldid=25361"