Difference between revisions of "CPD-7419"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-15_004120 == * left end position: ** 4402946 * transcription direction: ** POSITIVE * right end position: ** 4411593 * centisome position: ** 81.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7419 CPD-7419] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7419 CPD-7419] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N |
− | * | + | * common name: |
− | ** | + | ** β-zeacarotene |
− | * | + | * molecular weight: |
− | ** | + | ** 538.898 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8038]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIPID_MAPS : LMPR01070259 | |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280790 5280790] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.4444348.html 4444348] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27533 27533] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05434 C05434] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1)}} | ||
+ | {{#set: inchi key=InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N}} | ||
+ | {{#set: common name=β-zeacarotene}} | ||
+ | {{#set: molecular weight=538.898 }} | ||
+ | {{#set: reversible reaction associated=RXN-8038}} |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD-7419
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1)
- inchi key:
- InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N
- common name:
- β-zeacarotene
- molecular weight:
- 538.898
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links