Difference between revisions of "CPD-15172"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Pro Protein-With-N-Terminal-Pro] == * common name: ** a peptide with an...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Pro Protein-With-N-Terminal-Pro] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
 +
* smiles:
 +
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
 +
* inchi key:
 +
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
 
* common name:
 
* common name:
** a peptide with an N-terminal L-proline
+
** 6,7-dehydrobaicalein
 +
* molecular weight:
 +
** 268.225   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.11.1-RXN]]
+
* [[RXN-14240]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a peptide with an N-terminal L-proline}}
+
* PUBCHEM:
{{#set: produced by=3.4.11.1-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
 +
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
 +
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
 +
{{#set: common name=6,7-dehydrobaicalein}}
 +
{{#set: molecular weight=268.225    }}
 +
{{#set: produced by=RXN-14240}}

Latest revision as of 19:13, 21 March 2018

Metabolite CPD-15172

  • smiles:
    • C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
  • inchi key:
    • InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
  • common name:
    • 6,7-dehydrobaicalein
  • molecular weight:
    • 268.225
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links