Difference between revisions of "STRICTOSIDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] == * smiles: ** C1(O)(C(OP([O-])([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O |
* common name: | * common name: | ||
| − | ** | + | ** strictosidine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 531.581 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-α(S)-strictosidine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 20824-29-7 |
| − | + | ||
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}} |
| − | {{#set: molecular weight= | + | {{#set: common name=strictosidine}} |
| − | {{#set: common name= | + | {{#set: molecular weight=531.581 }} |
| − | {{#set: | + | {{#set: common name=3-α(S)-strictosidine}} |
| − | + | {{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}} | |
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite STRICTOSIDINE
- smiles:
- C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
- inchi key:
- InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
- common name:
- strictosidine
- molecular weight:
- 531.581
- Synonym(s):
- 3-α(S)-strictosidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))" cannot be used as a page name in this wiki.
