Difference between revisions of "PWY-2161"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
−
** 18-hydroxylinoleoyl-CoA
+
** folate polyglutamylation
−
* molecular weight:
+
−
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ω-hydroxylinoleoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-16118]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-01_004980]]
 +
*** [[Ec-07_002300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FORMATETHFLIG-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-25_001900]]
 +
*** [[Ec-01_009540]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-01_004980]]
 +
*** [[Ec-07_002300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLYOHMETRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_004260]]
 +
*** [[Ec-24_002640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-2921]]
 +
** 2 associated gene(s):
 +
*** [[Ec-01_004980]]
 +
*** [[Ec-07_002300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659898 90659898]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-2161 PWY-2161]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84904 84904]
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: inchi key=InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J}}
+
{{#set: common name=folate polyglutamylation}}
−
{{#set: common name=18-hydroxylinoleoyl-CoA}}
+
{{#set: reaction found=5}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: total reaction=5}}
−
{{#set: common name=ω-hydroxylinoleoyl-CoA}}
+
{{#set: completion rate=100.0}}
−
{{#set: consumed by=RXN-16118}}
+

Latest revision as of 20:13, 21 March 2018

Pathway PWY-2161

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-2161&oldid=25435"