Difference between revisions of "Ec-17 003520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
(Created page with "Category:Gene == Gene Ec-17_003520 == * left end position: ** 3706160 * transcription direction: ** NEGATIVE * right end position: ** 3712032 * centisome position: ** 77.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
+
== Gene Ec-17_003520 ==
−
* smiles:
+
* left end position:
−
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
+
** 3706160
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** 3712032
−
* molecular weight:
+
* centisome position:
−
** 266.253    
+
** 77.244705    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
+
** Esi_0166_0045
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
+
** Esi0166_0045
 +
** SPPS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15680]]
+
* Reaction: [[RXN-11486]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-9003]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9384]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-5180]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY3O-19]]
 +
* [[PWY-6520]]
 +
* [[PWY-7235]]
 +
* [[PWY-5805]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3706160}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
+
{{#set: right end position=3712032}}
−
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
+
{{#set: centisome position=77.244705   }}
−
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=Esi_0166_0045|Esi0166_0045|SPPS}}
−
{{#set: molecular weight=266.253   }}
+
{{#set: reaction associated=RXN-11486|RXN-9003|RXN-9384|RXN0-5180|TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN}}
−
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: pathway associated=PWY3O-19|PWY-6520|PWY-7235|PWY-5805}}
−
{{#set: consumed by=RXN-15680}}
+

Latest revision as of 20:13, 21 March 2018

Gene Ec-17_003520

  • left end position:
    • 3706160
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3712032
  • centisome position:
    • 77.244705
  • Synonym(s):
    • Esi_0166_0045
    • Esi0166_0045
    • SPPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_003520&oldid=25443"