Difference between revisions of "Ec-17 003520"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-17_003520 == * left end position: ** 3706160 * transcription direction: ** NEGATIVE * right end position: ** 3712032 * centisome position: ** 77.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-17_003520 == |
− | * | + | * left end position: |
− | ** | + | ** 3706160 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3712032 |
− | * | + | * centisome position: |
− | ** | + | ** 77.244705 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0166_0045 |
− | ** | + | ** Esi0166_0045 |
+ | ** SPPS | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-11486]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-9003]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-9384]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN0-5180]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY3O-19]] | ||
+ | * [[PWY-6520]] | ||
+ | * [[PWY-7235]] | ||
+ | * [[PWY-5805]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3706160}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=3712032}} |
− | {{#set: | + | {{#set: centisome position=77.244705 }} |
− | {{#set: | + | {{#set: common name=Esi_0166_0045|Esi0166_0045|SPPS}} |
− | {{#set: | + | {{#set: reaction associated=RXN-11486|RXN-9003|RXN-9384|RXN0-5180|TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN}} |
− | {{#set: common name= | + | {{#set: pathway associated=PWY3O-19|PWY-6520|PWY-7235|PWY-5805}} |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Gene Ec-17_003520
- left end position:
- 3706160
- transcription direction:
- NEGATIVE
- right end position:
- 3712032
- centisome position:
- 77.244705
- Synonym(s):
- Esi_0166_0045
- Esi0166_0045
- SPPS
Reactions associated
- Reaction: RXN-11486
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-9003
- Source: orthology-aragem
- Reaction: RXN-9384
- Source: orthology-aragem
- Reaction: RXN0-5180
- Source: orthology-aragem
- Reaction: TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome