Difference between revisions of "RXN-16761"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] == * smiles: ** C1(=CC=C(C([O-])=O)C=N1) * inchi key: ** InChIKey=PVNIIMVLHYAW...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16761 RXN-16761] == * direction: ** REVERSIBLE * common name: ** Dolichyl-diphosphooligosacchar...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16761 RXN-16761] ==
−
* smiles:
+
* direction:
−
** C1(=CC=C(C([O-])=O)C=N1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** nicotinate
+
** Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A, N-terminal fragment, family GT66
−
* molecular weight:
+
** Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit Swp1
−
** 122.103   
+
** DAD/Ost2
 +
** Ribophorin I
 +
** Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit WBP1
 +
** Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A, C-terminal fragment, family GT66
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.4.99.18 EC-2.4.99.18]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-pyridinecarboxylic acid
 
−
** nicotinic acid
 
−
** wampocap
 
−
** nicolar
 
−
** nicocap
 
−
** nicobid
 
−
** nico-400-
 
−
** nicamin
 
−
** niacin
 
−
** niacine
 
−
** vitamin B3
 
−
** 3-pyridinecarboxylate
 
−
** pyridine-3-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OLIGOSACCHARIDE-DIPHOSPHODOLICHOL]][c] '''+''' 1 [[Protein-L-Asparagine]][c] '''<=>''' 1 [[CPD-224]][c] '''+''' 1 [[Glycoprotein-Asn-oligosaccharides]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 dolichyl diphosphooligosaccharide[c] '''+''' 1 a [protein]-L-asparagine[c] '''<=>''' 1 a dolichyl diphosphate[c] '''+''' 1 a [glycoprotein]-L-asparagine-[oligosaccharide][c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002490]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-07_004230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-09_000810]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_004370]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_007060]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_007050]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 59-67-6
+
{{#set: direction=REVERSIBLE}}
−
* BIGG : 34401
+
{{#set: common name=Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A, N-terminal fragment, family GT66}}
−
* PUBCHEM:
+
{{#set: common name=Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit Swp1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=937 937]
+
{{#set: common name=DAD/Ost2}}
−
* HMDB : HMDB01488
+
{{#set: common name=Ribophorin I}}
−
* LIGAND-CPD:
+
{{#set: common name=Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit WBP1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00253 C00253]
+
{{#set: common name=Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A, C-terminal fragment, family GT66}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.4.99.18}}
−
** [http://www.chemspider.com/Chemical-Structure.912.html 912]
+
{{#set: gene associated=Ec-22_002490|Ec-07_004230|Ec-09_000810|Ec-14_004370|Ec-00_007060|Ec-00_007050}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32544 32544]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC32544
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C1(=CC=C(C([O-])=O)C=N1)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M}}
+
−
{{#set: common name=nicotinate}}
+
−
{{#set: molecular weight=122.103    }}
+
−
{{#set: common name=3-pyridinecarboxylic acid|nicotinic acid|wampocap|nicolar|nicocap|nicobid|nico-400-|nicamin|niacin|niacine|vitamin B3|3-pyridinecarboxylate|pyridine-3-carboxylate}}
+
−
{{#set: consumed by=NICOTINATEPRIBOSYLTRANS-RXN}}
+

Latest revision as of 19:14, 21 March 2018

Reaction RXN-16761

  • direction:
    • REVERSIBLE
  • common name:
    • Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A, N-terminal fragment, family GT66
    • Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit Swp1
    • DAD/Ost2
    • Ribophorin I
    • Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit WBP1
    • Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A, C-terminal fragment, family GT66
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16761&oldid=25482"