Difference between revisions of "CPD-17045"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_001900 == * left end position: ** 1868761 * transcription direction: ** NEGATIVE * right end position: ** 1873687 * centisome position: ** 36.2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-20_001900 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
* left end position:
+
* smiles:
** 1868761
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
* right end position:
+
* common name:
** 1873687
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
* centisome position:
+
* molecular weight:
** 36.241436    
+
** 266.253    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0023_0089
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
** Esi0023_0089
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN0-5419]]
+
* [[RXN-15680]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1868761}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
{{#set: right end position=1873687}}
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
{{#set: centisome position=36.241436   }}
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
{{#set: common name=Esi_0023_0089|Esi0023_0089}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
{{#set: reaction associated=RXN0-5419}}
+
{{#set: molecular weight=266.253   }}
 +
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: consumed by=RXN-15680}}

Latest revision as of 19:14, 21 March 2018

Metabolite CPD-17045

  • smiles:
    • C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
  • inchi key:
    • InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 266.253
  • Synonym(s):
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links