Difference between revisions of "CPD-13936"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_003270 == * left end position: ** 4238043 * transcription direction: ** POSITIVE * right end position: ** 4239254 * centisome position: ** 57.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13936 CPD-13936] == * smiles: ** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13936 CPD-13936] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%14(OC(CO)C(O)C(O)C(OC%13(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%12(OC(CO)C(O)C(O)C(OC%11(C(O)C(O)C(O)C(CO)O%11))%12))))%13))%14))))O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KUYCTNQKTFGPMI-SXHURMOUSA-N |
− | * | + | * common name: |
− | ** | + | ** Glc3Man9GlcNAc2 |
− | * | + | * molecular weight: |
− | ** | + | ** 2370.108 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[3.1. | + | * [[3.2.1.106-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658561 90658561] |
− | {{#set: | + | {{#set: smiles=CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%14(OC(CO)C(O)C(O)C(OC%13(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%12(OC(CO)C(O)C(O)C(OC%11(C(O)C(O)C(O)C(CO)O%11))%12))))%13))%14))))O)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=KUYCTNQKTFGPMI-SXHURMOUSA-N}} |
− | {{#set: | + | {{#set: common name=Glc3Man9GlcNAc2}} |
− | {{#set: | + | {{#set: molecular weight=2370.108 }} |
+ | {{#set: consumed by=3.2.1.106-RXN}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-13936
- smiles:
- CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%14(OC(CO)C(O)C(O)C(OC%13(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%12(OC(CO)C(O)C(O)C(OC%11(C(O)C(O)C(O)C(CO)O%11))%12))))%13))%14))))O)
- inchi key:
- InChIKey=KUYCTNQKTFGPMI-SXHURMOUSA-N
- common name:
- Glc3Man9GlcNAc2
- molecular weight:
- 2370.108
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%14(OC(CO)C(O)C(O)C(OC%13(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%12(OC(CO)C(O)C(O)C(OC%11(C(O)C(O)C(O)C(CO)O%11))%12))))%13))%14))))O)" cannot be used as a page name in this wiki.