Difference between revisions of "Ec-13 002810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Ec-13_002810 == * left end position: ** 4537932 * transcription direction: ** POSITIVE * right end position: ** 4561569 * centisome position: ** 65.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Gene Ec-13_002810 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 4537932
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
** 4561569
−
* molecular weight:
+
* centisome position:
−
** 987.845    
+
** 65.42326    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
+
** Esi_0357_0003
−
** (S)-3-hydroxy-14:1-Δ5-CoA
+
** Esi0357_0003
−
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DUTP-PYROP-RXN]]
−
* [[RXN0-5393]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14139]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-14140]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-1602]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-1603]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-385]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-6382]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7206]]
 +
* [[PWY-7184]]
 +
* [[PWY-7187]]
 +
* [[PWY-6545]]
 +
* [[PWY0-166]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4537932}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: right end position=4561569}}
−
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: centisome position=65.42326   }}
−
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: common name=Esi_0357_0003|Esi0357_0003}}
−
{{#set: molecular weight=987.845   }}
+
{{#set: reaction associated=DUTP-PYROP-RXN|RXN-14139|RXN-14140|RXN0-1602|RXN0-1603|RXN0-385|RXN0-6382}}
−
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
{{#set: pathway associated=PWY-7206|PWY-7184|PWY-7187|PWY-6545|PWY0-166}}
−
{{#set: produced by=RXN0-5393}}
+

Latest revision as of 19:15, 21 March 2018

Gene Ec-13_002810

  • left end position:
    • 4537932
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4561569
  • centisome position:
    • 65.42326
  • Synonym(s):
    • Esi_0357_0003
    • Esi0357_0003

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_002810&oldid=25587"