Difference between revisions of "CPD-9610"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13682 RXN-13682] == * direction: ** REVERSIBLE * common name: ** 3-oxo-5-alpha-steroid 4-dehydr...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13682 RXN-13682] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
 +
* inchi key:
 +
** InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K
 
* common name:
 
* common name:
−
** 3-oxo-5-alpha-steroid 4-dehydrogenase
+
** all-trans-decaprenyl diphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.99.5 EC-1.3.99.5]
+
** 856.133   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9230]]
−
** 1 [[3-Oxo-5-Alpha-Steroids]][c] '''+''' 1 [[Acceptor]][c] '''<=>''' 1 [[3-Oxo-Delta-4-Steroids]][c] '''+''' 1 [[Donor-H2]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 3-oxo-5-&alpha;-steroid[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''<=>''' 1 a 3-oxo-&Delta;4-steroid[c] '''+''' 1 an reduced unknown electron acceptor[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_006180]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: common name=3-oxo-5-alpha-steroid 4-dehydrogenase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C17432 C17432]
−
{{#set: ec number=EC-1.3.99.5}}
+
* CHEBI:
−
{{#set: gene associated=Ec-02_006180}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60721 60721]
−
{{#set: in pathway=}}
+
* PUBCHEM:
−
{{#set: reconstruction category=annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245574 25245574]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* HMDB : HMDB59616
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
 +
{{#set: inchi key=InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K}}
 +
{{#set: common name=all-trans-decaprenyl diphosphate}}
 +
{{#set: molecular weight=856.133    }}
 +
{{#set: consumed by=RXN-9230}}

Latest revision as of 19:15, 21 March 2018

Metabolite CPD-9610

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
  • inchi key:
    • InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K
  • common name:
    • all-trans-decaprenyl diphosphate
  • molecular weight:
    • 856.133
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-9610&oldid=25648"