Difference between revisions of "PWY-7158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7158 PWY-7158] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7158 PWY-7158] ==
* smiles:
+
* taxonomic range:
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
+
** L-phenylalanine degradation V
* molecular weight:
+
** 441.673   
+
 
* Synonym(s):
 
* Synonym(s):
** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
 
** 4β-methylzymosterol-4α-carboxylate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-313]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-13908]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-12_001420]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13907 RXN-13907]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13909 RXN-13909]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657655 90657655]
+
{{#set: common name=L-phenylalanine degradation V}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925]
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808]
+
* HMDB : HMDB06927
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: molecular weight=441.673    }}
+
{{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}}
+
{{#set: consumed by=RXN66-313}}
+

Latest revision as of 19:16, 21 March 2018

Pathway PWY-7158

  • taxonomic range:
  • common name:
    • L-phenylalanine degradation V
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links