Difference between revisions of "RXN-14273"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14273 RXN-14273] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-tetradec-2-enoyl-CoA...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14273 RXN-14273] ==
−
* smiles:
+
* direction:
−
** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
+
 
* common name:
 
* common name:
−
** adenosyl-cobyrinate a,c-diamide
+
** trans-tetradec-2-enoyl-CoA hydratase
−
* molecular weight:
+
** ClpP/crotonase-like domain
−
** 1182.137   
+
** Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
 +
** enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
 
* Synonym(s):
 
* Synonym(s):
−
** adenosyl-cobyrinic acid a,c-diamide
 
−
** Adenosyl cobyrinate diamide
 
−
** Adenosylcob(III)yrinic acid a,c-diamide
 
−
** Adenosylcobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[R344-RXN]]
+
** 1 [[CPD-15568]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-2171]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-trans-tetradecenoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 (S)-3-hydroxytetradecanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_001250]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-16_003560]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_001380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''5''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31173 31173]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04740 R04740]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506]
+
{{#set: common name=trans-tetradec-2-enoyl-CoA hydratase}}
−
* HMDB : HMDB01083
+
{{#set: common name=ClpP/crotonase-like domain}}
−
{{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}}
+
{{#set: common name=Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ}}
−
{{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}}
+
{{#set: common name=enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase}}
−
{{#set: common name=adenosyl-cobyrinate a,c-diamide}}
+
{{#set: ec number=EC-4.2.1.17}}
−
{{#set: molecular weight=1182.137    }}
+
{{#set: gene associated=Ec-16_001250|Ec-14_006530|Ec-16_003560|Ec-06_001380}}
−
{{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}}
+
{{#set: in pathway=PWY-7654}}
−
{{#set: produced by=R344-RXN}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:16, 21 March 2018

Reaction RXN-14273

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-tetradec-2-enoyl-CoA hydratase
    • ClpP/crotonase-like domain
    • Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
    • enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 2-trans-tetradecenoyl-CoA[c] + 1 H2O[c] => 1 (S)-3-hydroxytetradecanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 5 reactions found over 11 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14273&oldid=25782"