Difference between revisions of "PWY-5938"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5938 PWY-5938] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5938 PWY-5938] ==
* smiles:
+
* taxonomic range:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
 
* common name:
 
* common name:
** 24-methylenecholesterol
+
** (R)-acetoin biosynthesis I
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** D-acetoin biosynthesis I
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-707]]
+
* [[ACETOLACTSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-6081]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11036 RXN-11036]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724573 23724573]
+
{{#set: taxonomic range=TAX-2}}
* LIGAND-CPD:
+
{{#set: common name=(R)-acetoin biosynthesis I}}
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: common name=D-acetoin biosynthesis I}}
* HMDB : HMDB06849
+
{{#set: reaction found=2}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: completion rate=67.0}}
{{#set: common name=24-methylenecholesterol}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN-707}}
+

Latest revision as of 19:16, 21 March 2018

Pathway PWY-5938

  • taxonomic range:
  • common name:
    • (R)-acetoin biosynthesis I
  • Synonym(s):
    • D-acetoin biosynthesis I

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links