Difference between revisions of "CPD-7414"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] == * common name: ** a [protein] N-terminal amin...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] ==
 +
* smiles:
 +
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
 +
* inchi key:
 +
** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
 
* common name:
 
* common name:
** a [protein] N-terminal amino acid
+
** ε-carotene
 +
* molecular weight:
 +
** 536.882   
 
* Synonym(s):
 
* Synonym(s):
** an N-terminal amino acid-[protein]
+
** ε,ε-carotene
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15564]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8028]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [protein] N-terminal amino acid}}
+
* PUBCHEM:
{{#set: common name=an N-terminal amino acid-[protein]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808]
{{#set: consumed by=RXN-15564}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276]
 +
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}}
 +
{{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}}
 +
{{#set: common name=ε-carotene}}
 +
{{#set: molecular weight=536.882    }}
 +
{{#set: common name=ε,ε-carotene}}
 +
{{#set: produced by=RXN-8028}}

Latest revision as of 19:17, 21 March 2018

Metabolite CPD-7414

  • smiles:
    • CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
  • inchi key:
    • InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
  • common name:
    • ε-carotene
  • molecular weight:
    • 536.882
  • Synonym(s):
    • ε,ε-carotene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links