Difference between revisions of "BETAINE ALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] == * smiles: ** C[N+](C)(C[CH]=O)C * inchi key: ** InChIKey=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C[N+](C)(C[CH]=O)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** betaine aldehyde |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 102.156 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** glycine betaine aldehyde |
| − | ** | + | ** N,N,N-trimethyl-2-oxoethylammonium |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17758]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-7230]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[BADH-RXN]] | ||
| + | * [[CHD-RXN]] | ||
| + | * [[RXN-6268]] | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 7418-61-3 |
| + | * BIGG : 35400 | ||
| + | * DRUGBANK : DB04401 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=249 249] |
| − | {{#set: smiles= | + | * HMDB : HMDB01252 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00576 C00576] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.244.html 244] |
| − | {{#set: consumed by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15710 15710] | ||
| + | * METABOLIGHTS : MTBLC15710 | ||
| + | {{#set: smiles=C[N+](C)(C[CH]=O)C}} | ||
| + | {{#set: inchi key=InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=betaine aldehyde}} | ||
| + | {{#set: molecular weight=102.156 }} | ||
| + | {{#set: common name=glycine betaine aldehyde|N,N,N-trimethyl-2-oxoethylammonium}} | ||
| + | {{#set: consumed by=RXN-17758}} | ||
| + | {{#set: produced by=RXN0-7230}} | ||
| + | {{#set: reversible reaction associated=BADH-RXN|CHD-RXN|RXN-6268}} | ||
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite BETAINE_ALDEHYDE
- smiles:
- C[N+](C)(C[CH]=O)C
- inchi key:
- InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N
- common name:
- betaine aldehyde
- molecular weight:
- 102.156
- Synonym(s):
- glycine betaine aldehyde
- N,N,N-trimethyl-2-oxoethylammonium
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7418-61-3
- BIGG : 35400
- DRUGBANK : DB04401
- PUBCHEM:
- HMDB : HMDB01252
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15710
"C[N+](C)(C[CH]=O)C" cannot be used as a page name in this wiki.
