Difference between revisions of "Ec-04 002190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * smiles: ** C[S+](CCC[N+])CC1(OC(C(O)C(O...")
(Created page with "Category:Gene == Gene Ec-04_002190 == * left end position: ** 2454522 * transcription direction: ** NEGATIVE * right end position: ** 2467918 * centisome position: ** 37.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] ==
+
== Gene Ec-04_002190 ==
−
* smiles:
+
* left end position:
−
** C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))
+
** 2454522
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** S-adenosyl 3-(methylthio)propylamine
+
** 2467918
−
* molecular weight:
+
* centisome position:
−
** 356.442    
+
** 37.693153    
 
* Synonym(s):
 
* Synonym(s):
−
** S-adenosyl-(5')-3-methylthiopropylamine
+
** Esi_0015_0036
−
** dcSAM
+
** Esi0015_0036
−
** decarboxylated AdoMet
+
−
** (5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt
+
−
** decarboxylated SAM
+
−
** S-adenosylmethioninamine
+
−
** decarboxylated S-adenosylmethionine
+
−
** dAdoMet
+
−
** S-methyl-S-adenosyl homocysteamine
+
−
** 3-amino-propyl-S-adenosine
+
−
** S-adenosyl-L-methioninamine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[SPERMINE-SYNTHASE-RXN]]
+
* Reaction: [[3.2.1.21-RXN]]
−
* [[RXN0-5217]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
* [[SAMDECARB-RXN]]
+
* Reaction: [[RXN-10769]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[SPERMIDINESYN-RXN]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 +
* [[PWY-7089]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 36895
+
{{#set: left end position=2454522}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203490 25203490]
+
{{#set: right end position=2467918}}
−
* HMDB : HMDB00988
+
{{#set: centisome position=37.693153   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0015_0036|Esi0015_0036}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01137 C01137]
+
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13600|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091|PWY-7089}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57443 57443]
+
−
* METABOLIGHTS : MTBLC57443
+
−
{{#set: smiles=C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))}}
+
−
{{#set: inchi key=InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O}}
+
−
{{#set: common name=S-adenosyl 3-(methylthio)propylamine}}
+
−
{{#set: molecular weight=356.442   }}
+
−
{{#set: common name=S-adenosyl-(5')-3-methylthiopropylamine|dcSAM|decarboxylated AdoMet|(5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt|decarboxylated SAM|S-adenosylmethioninamine|decarboxylated S-adenosylmethionine|dAdoMet|S-methyl-S-adenosyl homocysteamine|3-amino-propyl-S-adenosine|S-adenosyl-L-methioninamine}}
+
−
{{#set: consumed by=SPERMINE-SYNTHASE-RXN|RXN0-5217}}
+
−
{{#set: produced by=SAMDECARB-RXN}}
+
−
{{#set: reversible reaction associated=SPERMIDINESYN-RXN}}
+

Latest revision as of 19:17, 21 March 2018

Gene Ec-04_002190

  • left end position:
    • 2454522
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2467918
  • centisome position:
    • 37.693153
  • Synonym(s):
    • Esi_0015_0036
    • Esi0015_0036

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_002190&oldid=25830"