Difference between revisions of "Ec-00 001230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Gene == Gene Ec-00_001230 == * left end position: ** 1522933 * transcription direction: ** NEGATIVE * right end position: ** 1530049 * centisome position: ** 8.03...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] ==
+
== Gene Ec-00_001230 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1522933
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxo adrenoyl-CoA
+
** 1530049
−
* molecular weight:
+
* centisome position:
−
** 1091.996    
+
** 8.038100    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
+
** Esi_0013_0070
−
** 3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
+
** Esi0013_0070
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16112]]
+
* Reaction: [[2.6.1.7-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16079]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PHEAMINOTRANS-RXN]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-10721]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[ANAPHENOXI-PWY]]
 +
* [[PWY-5079]]
 +
* [[PWY-7432]]
 +
* [[PWY-6309]]
 +
* [[PHESYN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1522933}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581099 71581099]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1530049}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73852 73852]
+
{{#set: centisome position=8.038100   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0013_0070|Esi0013_0070}}
−
{{#set: inchi key=InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J}}
+
{{#set: reaction associated=2.6.1.7-RXN|PHEAMINOTRANS-RXN|RXN-10721}}
−
{{#set: common name=3-oxo adrenoyl-CoA}}
+
{{#set: pathway associated=ANAPHENOXI-PWY|PWY-5079|PWY-7432|PWY-6309|PHESYN}}
−
{{#set: molecular weight=1091.996   }}
+
−
{{#set: common name=3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16112}}
+
−
{{#set: produced by=RXN-16079}}
+

Latest revision as of 19:17, 21 March 2018

Gene Ec-00_001230

  • left end position:
    • 1522933
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1530049
  • centisome position:
    • 8.038100
  • Synonym(s):
    • Esi_0013_0070
    • Esi0013_0070

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_001230&oldid=25866"