Difference between revisions of "RXN-16475"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16475 RXN-16475] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16475 RXN-16475] ==
* smiles:
+
* direction:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
+
* common name:
+
** 6-deoxocathasterone
+
* molecular weight:
+
** 418.702   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxocathasterone
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-773]]
+
** 1 [[CPD-13122]][c] '''<=>''' 1 [[CPD-37]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4-deoxy-L-threo-hex-4-enopyranuronate[c] '''<=>''' 1 5-dehydro-4-deoxy-D-glucuronate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6507]], 4-deoxy-L-threo-hex-4-enopyranuronate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6507 PWY-6507]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01030124
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: in pathway=PWY-6507}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202530 25202530]
+
{{#set: reconstruction category=annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
+
{{#set: reconstruction tool=pathwaytools}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
+
{{#set: common name=6-deoxocathasterone}}
+
{{#set: molecular weight=418.702    }}
+
{{#set: common name=deoxocathasterone}}
+
{{#set: produced by=RXN-773}}
+

Latest revision as of 19:17, 21 March 2018

Reaction RXN-16475

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4-deoxy-L-threo-hex-4-enopyranuronate[c] <=> 1 5-dehydro-4-deoxy-D-glucuronate[c]

Genes associated with this reaction

Pathways

  • PWY-6507, 4-deoxy-L-threo-hex-4-enopyranuronate degradation: PWY-6507
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links