Difference between revisions of "ASCORBATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5399 PWY-5399] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** L-ascorbate |
| + | * molecular weight: | ||
| + | ** 175.118 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-ascorbic acid | ||
| + | ** ascorbate | ||
| + | ** vitamin C | ||
| + | ** ascorbic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-3521]] | |
| − | * [[RXN- | + | * [[RXN-10981]] |
| − | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | |
| − | + | * [[RXN-12440]] | |
| − | + | * [[RXN-12876]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-3523]] | |
| − | * [[RXN- | + | * [[1.6.5.4-RXN]] |
| − | + | * [[RXN-12440]] | |
| − | + | * [[1.8.5.1-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 50-81-7 |
| − | {{#set: | + | * BIGG : 33747 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54679076 54679076] |
| − | {{#set: | + | * KNAPSACK : C00001179 |
| − | {{#set: | + | * HMDB : HMDB00044 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00072 C00072] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.102746.html 102746] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38290 38290] | ||
| + | * METABOLIGHTS : MTBLC38290 | ||
| + | {{#set: smiles=C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)}} | ||
| + | {{#set: inchi key=InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M}} | ||
| + | {{#set: common name=L-ascorbate}} | ||
| + | {{#set: molecular weight=175.118 }} | ||
| + | {{#set: common name=L-ascorbic acid|ascorbate|vitamin C|ascorbic acid}} | ||
| + | {{#set: consumed by=RXN-3521|RXN-10981|DOPAMINE-BETA-MONOOXYGENASE-RXN|RXN-12440|RXN-12876}} | ||
| + | {{#set: produced by=RXN-3523|1.6.5.4-RXN|RXN-12440|1.8.5.1-RXN}} | ||
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite ASCORBATE
- smiles:
- C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)
- inchi key:
- InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M
- common name:
- L-ascorbate
- molecular weight:
- 175.118
- Synonym(s):
- L-ascorbic acid
- ascorbate
- vitamin C
- ascorbic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-81-7
- BIGG : 33747
- PUBCHEM:
- KNAPSACK : C00001179
- HMDB : HMDB00044
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC38290
"C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)" cannot be used as a page name in this wiki.
