Difference between revisions of "ORNDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JCZF...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ORNDEG-PWY ORNDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ORNDEG-PWY ORNDEG-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** superpathway of ornithine degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
− | * [[ | + | * [[ORNDECARBOX-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-11_003270]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PUTDEG-PWY PUTDEG-PWY] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PUTDEG-PWY PUTDEG-PWY] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1221 PWY0-1221] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1221 PWY0-1221] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ORNDEG-PWY ORNDEG-PWY] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=superpathway of ornithine degradation}} | |
− | {{#set: | + | {{#set: reaction found=1}} |
− | + | {{#set: total reaction=5}} | |
− | {{#set: common name= | + | {{#set: completion rate=20.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:17, 21 March 2018
Pathway ORNDEG-PWY
- taxonomic range:
- common name:
- superpathway of ornithine degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- ORNDECARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: