Difference between revisions of "CPD-11407"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M |
* common name: | * common name: | ||
− | ** | + | ** thyroxine sulfate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 855.924 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** T4 sulfate |
− | ** | + | ** thyroxine-4-sulfate |
− | ** | + | ** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo- |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10614]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726] |
− | * | + | * CHEBI: |
− | {{#set: smiles=C( | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}} |
− | {{#set: molecular weight= | + | {{#set: common name=thyroxine sulfate}} |
− | {{#set: common name= | + | {{#set: molecular weight=855.924 }} |
− | + | {{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}} | |
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-10614}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-11407
- smiles:
- C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
- inchi key:
- InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
- common name:
- thyroxine sulfate
- molecular weight:
- 855.924
- Synonym(s):
- T4 sulfate
- thyroxine-4-sulfate
- L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)" cannot be used as a page name in this wiki.