Difference between revisions of "RXN0-5515"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] == * direction: ** LEFT-TO-RIGHT * common name: ** Phosphatidate cytidylyltran...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Phosphatidate cytidylyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.41 EC-2.7.7.41] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CTP]][c] '''+''' 1 [[2-3-4-Saturated-L-Phosphatidates]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CDP-2-3-4-Saturated-Diacylglycerols]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 CTP[c] '''+''' 1 a 2,3,4-saturated L-phosphatidate[c] '''+''' 1 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 a CDP-2,3,4-saturated-diacylglycerol[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Ec-05_001740]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-17_000480]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-15_001900]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-14_003790]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-14_002980]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-16_001970]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Phosphatidate cytidylyltransferase}} | |
− | + | {{#set: ec number=EC-2.7.7.41}} | |
− | + | {{#set: gene associated=Ec-05_001740|Ec-17_000480|Ec-15_001900|Ec-14_003790|Ec-14_002980|Ec-16_001970}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Contents
Reaction RXN0-5515
- direction:
- LEFT-TO-RIGHT
- common name:
- Phosphatidate cytidylyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CTP[c] + 1 2-3-4-Saturated-L-Phosphatidates[c] + 1 PROTON[c] => 1 PPI[c] + 1 CDP-2-3-4-Saturated-Diacylglycerols[c]
- With common name(s):
- 1 CTP[c] + 1 a 2,3,4-saturated L-phosphatidate[c] + 1 H+[c] => 1 diphosphate[c] + 1 a CDP-2,3,4-saturated-diacylglycerol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-05_001740
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-17_000480
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-15_001900
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_003790
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_002980
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_001970
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome